Etebenecid structure
|
Common Name | Etebenecid | ||
|---|---|---|---|---|
| CAS Number | 1213-06-5 | Molecular Weight | 257.30600 | |
| Density | 1.283g/cm3 | Boiling Point | 416.5ºC at 760mmHg | |
| Molecular Formula | C11H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
Use of EtebenecidEtebenecid is a uricosuric agents, lower uric acid levels in the body by increasing the elimination of uric acid by the kidneys, also inhibits penicillin tubular secretion. |
| Name | 4-(diethylsulfamoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Etebenecid is a uricosuric agents, lower uric acid levels in the body by increasing the elimination of uric acid by the kidneys, also inhibits penicillin tubular secretion. |
|---|---|
| Related Catalog |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760mmHg |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.30600 |
| Flash Point | 205.7ºC |
| Exact Mass | 257.07200 |
| PSA | 83.06000 |
| LogP | 2.49610 |
| Vapour Pressure | 1.11E-07mmHg at 25°C |
| InChIKey | UACOQEQOBAQRDQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| Storage condition | 2-8℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2935009090 |
|---|
|
~79%
Etebenecid CAS#:1213-06-5 |
| Literature: Havaldar, Freddy H.; Khatri, Navinchandra K. Heterocyclic Communications, 2006 , vol. 12, # 6 p. 453 - 456 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Ethebenecid |
| 4-Diethylsulfamoyl-benzoic acid |
| Ethebenecide |
| 4-[(Diethylamino)sulfonyl]benzoic acid |
| p-(Diethylsulfamoyl)benzoic acid |
| Urelim |
| Etebenecid |
| 4-Diaethylsulfamoyl-benzoesaeure |
| 4-Carboxy-N,N-diethylbenzenesulfonamide |