[(2S,5R)-5-(6-amino-8-bromopurin-9-yl)oxolan-2-yl]methanol structure
|
Common Name | [(2S,5R)-5-(6-amino-8-bromopurin-9-yl)oxolan-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 121353-86-4 | Molecular Weight | 314.13900 | |
| Density | 2.14g/cm3 | Boiling Point | 587.1ºC at 760mmHg | |
| Molecular Formula | C10H12BrN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.9ºC | |
| Name | [(2S,5R)-5-(6-amino-8-bromopurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.14g/cm3 |
|---|---|
| Boiling Point | 587.1ºC at 760mmHg |
| Molecular Formula | C10H12BrN5O2 |
| Molecular Weight | 314.13900 |
| Flash Point | 308.9ºC |
| Exact Mass | 313.01700 |
| PSA | 99.08000 |
| LogP | 1.42210 |
| Vapour Pressure | 1.26E-14mmHg at 25°C |
| Index of Refraction | 1.859 |
| InChIKey | GJDDMLRZHBSEJS-NTSWFWBYSA-N |
| SMILES | Nc1ncnc2c1nc(Br)n2C1CCC(CO)O1 |
|
~86%
[(2S,5R)-5-(6-a... CAS#:121353-86-4 |
| Literature: Zeidler, Joanna; Golankiewicz, Bozenna Nucleosides and Nucleotides, 1996 , vol. 15, # 5 p. 1077 - 1095 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Adenosine,8-bromo-2',3'-dideoxy-(9CI) |
| 8Br-ddA |
| Adenosine,8-bromo-2',3'-dideoxy |
| 8-Bromo-2',3'-dideoxyadenosine |