2-(Difluoromethyl)-4-fluoro-1-nitrobenzene structure
|
Common Name | 2-(Difluoromethyl)-4-fluoro-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1214333-17-1 | Molecular Weight | 191.107 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 254.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H4F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.7±25.9 °C | |
| Name | 2-(Difluoromethyl)-4-fluoro-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 254.5±35.0 °C at 760 mmHg |
| Molecular Formula | C7H4F3NO2 |
| Molecular Weight | 191.107 |
| Flash Point | 107.7±25.9 °C |
| Exact Mass | 191.019409 |
| PSA | 45.82000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | ADBUIWGABVQONJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(F)cc1C(F)F |
| Storage condition | 2-8°C |
| HS Code | 2904909090 |
|---|
|
~99%
2-(Difluorometh... CAS#:1214333-17-1 |
| Literature: GLAXO GROUP LIMITED; CHONG, Pek Yoke; MILLER, John F.; PEAT, Andrew James; SHOTWELL, John Brad Patent: WO2013/28371 A1, 2013 ; Location in patent: Page/Page column 52 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-difluoromethyl-4-fluoro-1-nitro-benzene |
| Benzene, 2-(difluoromethyl)-4-fluoro-1-nitro- |
| 2-Difluormethoxy-chinolin |
| 2-(Difluoromethyl)-4-fluoro-1-nitrobenzene |
| 2-difluoromethoxy-quinoline |