5-Fluoro-2-nitrobenzaldehyde structure
|
Common Name | 5-Fluoro-2-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 395-81-3 | Molecular Weight | 169.110 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 287.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4FNO3 | Melting Point | 92-94°C | |
| MSDS | USA | Flash Point | 127.7±23.2 °C | |
| Name | 5-Fluoro-2-nitrobenzadehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 287.6±25.0 °C at 760 mmHg |
| Melting Point | 92-94°C |
| Molecular Formula | C7H4FNO3 |
| Molecular Weight | 169.110 |
| Flash Point | 127.7±23.2 °C |
| Exact Mass | 169.017517 |
| PSA | 62.89000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | KKAFVHUJZPVWND-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(F)ccc1[N+](=O)[O-] |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| WNR DF BVH |
| 5-Fluoro-2-nitrobenzaldehyde |
| Benzaldehyde, 5-fluoro-2-nitro- |
| MFCD00153175 |
| EINECS 206-903-8 |
| 5-Fluoro-2-nitro benzadehyde |