Ethyl 5-bromo-6-hydroxypicolinate structure
|
Common Name | Ethyl 5-bromo-6-hydroxypicolinate | ||
|---|---|---|---|---|
| CAS Number | 1214346-74-3 | Molecular Weight | 246.058 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 414.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.2±27.3 °C | |
| Name | ethyl 5-bromo-6-oxo-1H-pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.1±40.0 °C at 760 mmHg |
| Molecular Formula | C8H8BrNO3 |
| Molecular Weight | 246.058 |
| Flash Point | 204.2±27.3 °C |
| Exact Mass | 244.968750 |
| PSA | 59.42000 |
| LogP | 1.32 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | QTOUGSSHYFZLKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(Br)c(=O)[nH]1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 5-bromo-6-hydroxypicolinate |
| Ethyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate |
| Ethyl 5-bromo-6-oxo-1,6-dihydro-2-pyridinecarboxylate |
| Ethyl 5-bromo-6-hydroxypyridine-2-carboxylate |
| 2-Pyridinecarboxylic acid, 5-bromo-1,6-dihydro-6-oxo-, ethyl ester |
| 2-pyridinecarboxylic acid, 5-bromo-6-hydroxy-, ethyl ester |