dimethyl 4-(4-methoxycarbonylphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate structure
|
Common Name | dimethyl 4-(4-methoxycarbonylphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 121497-05-0 | Molecular Weight | 359.37300 | |
| Density | 1.204g/cm3 | Boiling Point | 487.4ºC at 760mmHg | |
| Molecular Formula | C19H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.6ºC | |
| Name | dimethyl 4-(4-methoxycarbonylphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 487.4ºC at 760mmHg |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.37300 |
| Flash Point | 248.6ºC |
| Exact Mass | 359.13700 |
| PSA | 90.93000 |
| LogP | 2.38280 |
| Vapour Pressure | 1.19E-09mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | QFQGWFBVXYYUPD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccc(C(=O)OC)cc1 |
|
~72%
dimethyl 4-(4-m... CAS#:121497-05-0 |
| Literature: Mukherjee; Akhtar; Sharma; Seth; Bhaduri; Agnihotri; Mehrotra; Kamboj Journal of Medicinal Chemistry, 1989 , vol. 32, # 10 p. 2297 - 2300 |
|
~%
dimethyl 4-(4-m... CAS#:121497-05-0 |
| Literature: Legeay, Jean-Christophe; Vanden Eynde, Jean Jacques; Bazureau, Jean Pierre Tetrahedron, 2005 , vol. 61, # 52 p. 12386 - 12397 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| methyl 4-[3,5-bis(methoxycarbonyl)-2,6-dimethyl-4-1,4-dihydropyridyl]benzoate |
| dimethyl 4-[4-(methoxycarbonyl)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |