5-bromo-2-(tert-butyldimethylsilyloxy)pyrimidine structure
|
Common Name | 5-bromo-2-(tert-butyldimethylsilyloxy)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 121519-00-4 | Molecular Weight | 289.244 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 296.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C10H17BrN2OSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 132.9±25.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Bromo-2-((tert-butyldimethylsilyl)oxy)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.2±32.0 °C at 760 mmHg |
| Molecular Formula | C10H17BrN2OSi |
| Molecular Weight | 289.244 |
| Flash Point | 132.9±25.1 °C |
| Exact Mass | 288.029358 |
| PSA | 35.01000 |
| LogP | 3.48 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | GCALLZMACFTOPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ncc(Br)cn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~89%
5-bromo-2-(tert... CAS#:121519-00-4 |
| Literature: Arukwe, Joseph; Keilen, Gunnar; Undheim, Kjell Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1988 , vol. 42, # 8 p. 530 - 536 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (5-bromopyrimidin-2-yl)oxy-tert-butyl-dimethylsilane |
| Pyrimidine, 5-bromo-2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]- |
| MFCD01318957 |
| 5-Bromo-2-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}pyrimidine |
| 5-Bromo-2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]pyrimidine |
| T6N CNJ BO-SI-1&1&X1&1&1 EE |
| 5-Bromo-2-(tert-butyldimethylsiloxy)pyrimidine |
| 5-BROMO-2-(t-BUTYLDIMETHYLSILYL)PYRIMIDINE |