Benzenesulfonamide,4-chloro-N-(3-chlorophenyl)- structure
|
Common Name | Benzenesulfonamide,4-chloro-N-(3-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1216-98-4 | Molecular Weight | 302.17600 | |
| Density | 1.492g/cm3 | Boiling Point | 428.6ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | 4-chloro-N-(3-chlorophenyl)benzenesulfonamide |
|---|
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 428.6ºC at 760 mmHg |
| Molecular Formula | C12H9Cl2NO2S |
| Molecular Weight | 302.17600 |
| Flash Point | 213ºC |
| Exact Mass | 300.97300 |
| PSA | 54.55000 |
| LogP | 4.94800 |
| Vapour Pressure | 1.5E-07mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | WODOCQYEVFOZDC-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1)c1ccc(Cl)cc1 |
|
~%
Benzenesulfonam... CAS#:1216-98-4 |
| Literature: Journal of the Chemical Society, , vol. 107, p. 1822 |
|
~%
Benzenesulfonam... CAS#:1216-98-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 39, # 3 p. 558 - 565 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |