Metoclopramide-d3 structure
|
Common Name | Metoclopramide-d3 | ||
|---|---|---|---|---|
| CAS Number | 1216522-89-2 | Molecular Weight | 302.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19D3ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Metoclopramide-d3Metoclopramide-d3 is deuterium labeled Metoclopramide. Metoclopramide is a potent antagonist of 5-HT3 and dopamine D2 receptor, with IC50s of 308 nM and 483 nM, respectively. Metoclopramide can be used for the research of nausea and vomiting, gastro-oesophageal reflux, and gastroparesis[1][2]. |
| Name | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Metoclopramide-d3 is deuterium labeled Metoclopramide. Metoclopramide is a potent antagonist of 5-HT3 and dopamine D2 receptor, with IC50s of 308 nM and 483 nM, respectively. Metoclopramide can be used for the research of nausea and vomiting, gastro-oesophageal reflux, and gastroparesis[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C14H19D3ClN3O2 |
|---|---|
| Molecular Weight | 302.81 |
| Exact Mass | 302.15900 |
| PSA | 71.08000 |
| LogP | 3.15840 |
| InChIKey | TTWJBBZEZQICBI-HPRDVNIFSA-N |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC |
| Gastromax-d3 |
| Meclopran-d3 |
| Metoclopramide-d3 |
| Draclamid-d3 |
| Gastrese-d3 |
| Reliveran-d3 |
| Gastrotem-d3 |
| Gastrosil-d3 |
| Clopromate-d3 |
| Gastrobid-d3 |