metoclopramide sulfide structure
|
Common Name | metoclopramide sulfide | ||
|---|---|---|---|---|
| CAS Number | 102670-58-6 | Molecular Weight | 359.91500 | |
| Density | 1.18g/cm3 | Boiling Point | 496.3ºC at 760mmHg | |
| Molecular Formula | C16H26ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(2-methylsulfanylethoxy)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 496.3ºC at 760mmHg |
| Molecular Formula | C16H26ClN3O2S |
| Molecular Weight | 359.91500 |
| Flash Point | 254ºC |
| Exact Mass | 359.14300 |
| PSA | 96.38000 |
| LogP | 3.89160 |
| Vapour Pressure | 5.47E-10mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | QRIOIGZLWPJCCP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OCCSC |
|
~32%
metoclopramide ... CAS#:102670-58-6 |
| Literature: Bristol-Myers Company Patent: US4808624 A1, 1989 ; US 4808624 A |
|
~63%
metoclopramide ... CAS#:102670-58-6 |
| Literature: Monkovic; Brown; Luke; Standridge; Willner; Crosswell; Algieri; Buyniski; Crenshaw; Juby European Journal of Medicinal Chemistry, 1989 , vol. 24, # 3 p. 233 - 240 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-amino-5-chloro-2-<2-(methylthio)ethoxy>-N-<2-(diethylamino)ethyl>benzamide |
| 4-Amino-5-chloro-N-(2-(diethylamino)ethyl)-2-(2-(methylthio)ethoxy)benzamide |
| Metoclopramide sulfide |
| Benzamide,4-amino-5-chloro-N-(2-(diethylamino)ethyl)-2-(2-(methylthio)ethoxy) |
| 4-amino-5-chloro-N-(2-diethylaminoethyl)-2-(2-methylsulfanylethoxy)benzamide |