Methyl 4-(4'-fluorophenyl)-2-(cyclopropyl)-3-quinolinecarboxylate structure
|
Common Name | Methyl 4-(4'-fluorophenyl)-2-(cyclopropyl)-3-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 121659-86-7 | Molecular Weight | 321.345 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 458.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H16FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.9±28.7 °C | |
| Name | 4-(4-Fluorophenyl)-2-cyclopropylquinoline-3-carboxylic Acid Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.1±45.0 °C at 760 mmHg |
| Molecular Formula | C20H16FNO2 |
| Molecular Weight | 321.345 |
| Flash Point | 230.9±28.7 °C |
| Exact Mass | 321.116516 |
| PSA | 39.19000 |
| LogP | 4.76 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | RNXQZVFWKIPEOJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1 |
| HS Code | 2933499090 |
|---|
|
~95%
Methyl 4-(4'-fl... CAS#:121659-86-7 |
| Literature: SUMIKA FINE CHEMICALS Co., Ltd.; Nissan Chemical Industries, Ltd. Patent: EP1375487 A1, 2004 ; Location in patent: Page 5 ; |
|
~%
Methyl 4-(4'-fl... CAS#:121659-86-7 |
| Literature: US2012/16129 A1, ; |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinecarboxylate |
| 3-Quinolinecarboxylic acid, 2-cyclopropyl-4-(4-fluorophenyl)-, methyl ester |
| methyl 2-cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxylate |
| Methyl 4-(4'-fluorophenyl)-2-(cyclopropyl)-3-quinolinecarboxylate |