2-Amino-4'-fluorobenzophenone structure
|
Common Name | 2-Amino-4'-fluorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 3800-06-4 | Molecular Weight | 215.223 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 390.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H10FNO | Melting Point | 122-128°C | |
| MSDS | N/A | Flash Point | 190.0±23.7 °C | |
| Name | 2-Amino-4'-fluorobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.6±27.0 °C at 760 mmHg |
| Melting Point | 122-128°C |
| Molecular Formula | C13H10FNO |
| Molecular Weight | 215.223 |
| Flash Point | 190.0±23.7 °C |
| Exact Mass | 215.074646 |
| PSA | 43.09000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | FFFXIQFESQNINT-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)c1ccc(F)cc1 |
| Storage condition | Refrigerator |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (2-aminophenyl)-(4-fluorophenyl)methanone |
| (2-Amino-4'-fluoro-phenyl)-phenyl-methanone |
| MFCD06658166 |
| Methanone, (2-aminophenyl)(4-fluorophenyl)- |
| (2-Aminophenyl)(4-fluorophenyl)methanone |