Homo Sildenafil-d5 structure
|
Common Name | Homo Sildenafil-d5 | ||
|---|---|---|---|---|
| CAS Number | 1216711-61-3 | Molecular Weight | 493.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H27D5N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Homo Sildenafil-d5Homo Sildenafil-d5 is the deuterium labeled Homo Sildenafil. Homo Sildenafil, an analog of Sildenafil, acts as a phosphodiesterase inhibitor[1][2]. |
| Name | Homo Sildenafil-d5 |
|---|
| Description | Homo Sildenafil-d5 is the deuterium labeled Homo Sildenafil. Homo Sildenafil, an analog of Sildenafil, acts as a phosphodiesterase inhibitor[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C23H27D5N6O4S |
|---|---|
| Molecular Weight | 493.63 |
| InChIKey | MJEXYQIZUOHDGY-QKLSXCJMSA-N |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(CC)CC4)ccc3OCC)nc12 |