Nitrofurantoin-13C3 structure
|
Common Name | Nitrofurantoin-13C3 | ||
|---|---|---|---|---|
| CAS Number | 1217226-46-4 | Molecular Weight | 241.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C513C3H6N4O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
Use of Nitrofurantoin-13C3Nitrofurantoin-13C3is the 13C labeledNitrofurantoin(HY-A0090)[1]. Nitrofurantoin is a potent and orally active broad-spectrum beta-lactamase antimicrobial agent. Nitrofurantoin acts as an antibiotic and can be used for the study of urinary tract infections (UTIs), including cystitis and kidney infections[2]. |
| Name | 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione-13C3 |
|---|---|
| Synonym | More Synonyms |
| Description | Nitrofurantoin-13C3is the 13C labeledNitrofurantoin(HY-A0090)[1]. Nitrofurantoin is a potent and orally active broad-spectrum beta-lactamase antimicrobial agent. Nitrofurantoin acts as an antibiotic and can be used for the study of urinary tract infections (UTIs), including cystitis and kidney infections[2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C513C3H6N4O5 |
|---|---|
| Molecular Weight | 241.14 |
| Exact Mass | 241.04400 |
| PSA | 124.22000 |
| LogP | 0.81050 |
| InChIKey | NXFQHRVNIOXGAQ-PZGYLZBDSA-N |
| SMILES | O=C1CN(N=Cc2ccc([N+](=O)[O-])o2)C(=O)N1 |
| Storage condition | -20°C |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H317-H334 |
| Precautionary Statements | P261-P280-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-42/43 |
| Safety Phrases | 22-36/37-45 |
| RIDADR | NONH for all modes of transport |
| Chemiofuran-13C3 |
| Furadoxyl-13C3 |
| N-(5-Nitro-2-furfurylidene)-1-aminohydantoin-13C3,Furadoxyl-13C3 |
| Nifurantin-13C3 |
| Berkfurin-13C3 |
| Nitrofurantoin-13C3 |
| Novofuran-13C3 |
| Furadoin-13C3 |
| Furadoine-13C3 |
| Cyantin-13C3 |
| Furadantoin-13C3 |