N-Boc-4-azido-L-hoMoalanine (dicyclohexylaMMoniuM) salt structure
|
Common Name | N-Boc-4-azido-L-hoMoalanine (dicyclohexylaMMoniuM) salt | ||
|---|---|---|---|---|
| CAS Number | 1217459-14-7 | Molecular Weight | 425.56500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H39N5O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2S)-4-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid,N-cyclohexylcyclohexanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H39N5O4 |
|---|---|
| Molecular Weight | 425.56500 |
| Exact Mass | 425.30000 |
| PSA | 140.90000 |
| LogP | 4.95416 |
| InChIKey | UCLAYMPJMDBLOX-ZCMDIHMWSA-N |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.CC(C)(C)OC(=O)NC(CCN=[N+]=[N-])C(=O)[O-] |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Presentation and detection of azide functionality in bacterial cell surface proteins.
J. Am. Chem. Soc. 126 , 10598, (2004) An improved protocol for copper-catalyzed triazole formation on the bacterial cell surface is described. Addition of highly pure CuBr to cells treated with azidohomoalanine (2) leads to ca. 10-fold mo... |
| (S)-4-Azido-2-(Boc-amino)butyric acid (dicyclohexylammonium) salt |
| N-Boc-4-azido-L-homoalanine (dicyclohexylammonium) salt |
| N-Boc-4-azido-L-homoalanine dicyclohehylammonium salt |
| (S)-4-azido-2-{[(tert-butoxy)carbonyl]amino}butanoic acid dicyclohexylamine salt |