2-Methyl-2-propanyl (2R)-2-isobutyl-1-piperazinecarboxylate structure
|
Common Name | 2-Methyl-2-propanyl (2R)-2-isobutyl-1-piperazinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1217599-13-7 | Molecular Weight | 242.358 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 315.5±17.0 °C at 760 mmHg | |
| Molecular Formula | C13H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.6±20.9 °C | |
| Name | tert-butyl (2R)-2-(2-methylpropyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.5±17.0 °C at 760 mmHg |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.358 |
| Flash Point | 144.6±20.9 °C |
| Exact Mass | 242.199432 |
| PSA | 41.57000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | WXGGVOBNOVOVAM-LLVKDONJSA-N |
| SMILES | CC(C)CC1CNCCN1C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (R)-TERT-BUTYL 2-ISOBUTYLPIPERAZINE-1-CARBOXYLATE |
| 2-Methyl-2-propanyl (2R)-2-isobutyl-1-piperazinecarboxylate |
| 1-Piperazinecarboxylic acid, 2-(2-methylpropyl)-, 1,1-dimethylethyl ester, (2R)- |
| tert-butyl (2R)-2-isobutylpiperazine-1-carboxylate |
| 1-N-Boc-2R-isobutyl-Piperazine |
| (R)-1-Boc-2-isobutyl-piperazine |