Mecamylamine-d3 hydrochloride structure
|
Common Name | Mecamylamine-d3 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1217625-71-2 | Molecular Weight | 206.77100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19ClD3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mecamylamine-d3 hydrochlorideMecamylamine-d3 hydrochloride is the deuterium labeled Mecamylamine hydrochloride. Mecamylamine hydrochloride is an orally active, nonselective, noncompetitive nAChR antagonist that can treat various neuropsychiatric disorders. Mecamylamine hydrochloride is originally used as a ganglionic blocker in treating hypertension. Mecamylamine hydrochloride can easily crosses the blood-brain barrier[1][2]. |
| Name | (1R,3R,4S)-2,2,3-trimethyl-N-(trideuteriomethyl)bicyclo[2.2.1]heptan-3-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Mecamylamine-d3 hydrochloride is the deuterium labeled Mecamylamine hydrochloride. Mecamylamine hydrochloride is an orally active, nonselective, noncompetitive nAChR antagonist that can treat various neuropsychiatric disorders. Mecamylamine hydrochloride is originally used as a ganglionic blocker in treating hypertension. Mecamylamine hydrochloride can easily crosses the blood-brain barrier[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C11H19ClD3N |
|---|---|
| Molecular Weight | 206.77100 |
| Exact Mass | 206.16300 |
| PSA | 12.03000 |
| LogP | 3.61350 |
| InChIKey | PKVZBNCYEICAQP-HUGYAVALSA-N |
| SMILES | CNC1(C)C2CCC(C2)C1(C)C.Cl |
| Mecamine-d3 |
| Mecamylamine-d3 Hydrochloride |
| N,2,3,3-Tetramethyl-bicyclo[2.2.1]heptan-2-amine-d3 Hydrochloride |
| Inversine-d3 |
| Mevasine-d3 |
| N,2,3,3-Tetramethyl-2-norbornanamine-d3 Hydrochloride |
| Mevasin-d3 |
| CPDD 0059-d3 |