Clopidogrel-d3 hydrogen sulfate structure
|
Common Name | Clopidogrel-d3 hydrogen sulfate | ||
|---|---|---|---|---|
| CAS Number | 1217643-68-9 | Molecular Weight | 422.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15D3ClNO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Clopidogrel-d3 hydrogen sulfateClopidogrel-d3 (hydrogen sulfate) is the deuterium labeled Clopidogrel hydrogen sulfate[1]. Clopidogrel hydrogen sulfate is an antiplatelet agent to prevent blood clots. Clopidogrel hydrogen sulfate inhibits CYP2B6 and CYP2C19 with IC50s of 18.2 nM and 524 nM, respectively. Clopidogrel hydrogen sulfate is a potent antithrombotic agent that inhibits ADP-induced platelet aggregation.Clopidogrel hydrogen sulfate also is an orally active P2Y(12) inhibitor[2][3][4][5][6]. |
| Name | Clopidogrel-d3 hydrogen sulfate |
|---|
| Description | Clopidogrel-d3 (hydrogen sulfate) is the deuterium labeled Clopidogrel hydrogen sulfate[1]. Clopidogrel hydrogen sulfate is an antiplatelet agent to prevent blood clots. Clopidogrel hydrogen sulfate inhibits CYP2B6 and CYP2C19 with IC50s of 18.2 nM and 524 nM, respectively. Clopidogrel hydrogen sulfate is a potent antithrombotic agent that inhibits ADP-induced platelet aggregation.Clopidogrel hydrogen sulfate also is an orally active P2Y(12) inhibitor[2][3][4][5][6]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C16H15D3ClNO6S2 |
|---|---|
| Molecular Weight | 422.92 |
| InChIKey | FDEODCTUSIWGLK-CZXUMKGOSA-N |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCc2sccc2C1.O=S(=O)(O)O |