(S)-Methyl 3-amino-3-(4-chlorophenyl)propanoate HCl structure
|
Common Name | (S)-Methyl 3-amino-3-(4-chlorophenyl)propanoate HCl | ||
|---|---|---|---|---|
| CAS Number | 1217775-76-2 | Molecular Weight | 250.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl (3S)-3-amino-3-(4-chlorophenyl)propanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13Cl2NO2 |
|---|---|
| Molecular Weight | 250.12200 |
| Exact Mass | 249.03200 |
| PSA | 52.32000 |
| LogP | 3.40520 |
| InChIKey | CKHLTQXMMBPPQU-FVGYRXGTSA-N |
| SMILES | COC(=O)CC(N)c1ccc(Cl)cc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (S)-Methyl 3-amino-3-(4-chlorophenyl)propanoate hydrochloride |
| (S)-METHYL 3-AMINO-3-(4-CHLOROPHENYL)PROPANOATE HCl |
| I01-8987 |