N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine structure
|
Common Name | N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 1218-40-2 | Molecular Weight | 246.348 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 396.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C15H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4±25.1 °C | |
| Name | N,N-diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.2±32.0 °C at 760 mmHg |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.348 |
| Flash Point | 193.4±25.1 °C |
| Exact Mass | 246.173218 |
| PSA | 28.26000 |
| LogP | 3.04 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | KGDVJQQWCDDEPP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCc1c[nH]c2ccc(OC)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-3-ethanamine, N,N-diethyl-5-methoxy- |
| N,N-diethyl-5-methoxytryptamine |
| Diethyl-<2-(5-methoxy-indol-3-yl)-ethyl>-amin |
| N,N-Diethyl-2-(5-methoxy-1H-indol-3-yl)ethanamine |
| 3-(2-Diethylamino-ethyl)-5-methoxy-indol |
| diethyl-[2-(5-methoxy-indol-3-yl)-ethyl]-amine |
| 5-Methoxy-N,N-Diethyltryptamine(5-MeO-DET) |