4H-1-Benzopyran-4-one,6-fluoro-2-phenyl structure
|
Common Name | 4H-1-Benzopyran-4-one,6-fluoro-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 1218-82-2 | Molecular Weight | 240.22900 | |
| Density | 1.309g/cm3 | Boiling Point | 375.8ºC at 760mmHg | |
| Molecular Formula | C15H9FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.9ºC | |
| Name | 6-fluoro-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 375.8ºC at 760mmHg |
| Molecular Formula | C15H9FO2 |
| Molecular Weight | 240.22900 |
| Flash Point | 174.9ºC |
| Exact Mass | 240.05900 |
| PSA | 30.21000 |
| LogP | 3.59910 |
| Vapour Pressure | 7.56E-06mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | OUYOSBQKQPUNJK-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2ccc(F)cc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: In vivo antitumor activity against mouse S180 cells
Source: ChEMBL
Target: CCRF S-180
External Id: CHEMBL999160
|
|
Name: Inhibition of human TNKS1 (1030 to 1317) using NAD+ as substrate by fluorescence assa...
Source: ChEMBL
Target: Poly [ADP-ribose] polymerase tankyrase-1
External Id: CHEMBL2433652
|
|
Name: Experimentally measured binding affinity data (IC50) for protein-ligand complexes der...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-IC50 for protein-ligand complexes
|
|
Name: In vivo antitumor activity against mouse LLC cells
Source: ChEMBL
Target: Lewis lung carcinoma cell line
External Id: CHEMBL1002693
|
|
Name: Cytotoxicity against LPS-stimulated mouse RAW264.7 cells assessed as cell viability a...
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL4029931
|
|
Name: Displacement of [3H]flunitrazepine binding from GABA-A central benzodiazepine recepto...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-3
External Id: CHEMBL652454
|
|
Name: Antiinflammatory activity in mouse RAW264.7 cells assessed as inhibition of LPS-stimu...
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL4029928
|
| 6-Fluoroflavanone |
| 6-fluoro-2-phenyl-4H-1-benzopyran-4-one |
| 6-fluoro-2-phenyl-chromen-4-one |
| 6-fluoro-2-phenyl-4h-chromen-4-one |
| 6-Fluoroflavone |