4H-1-Benzopyran-4-one,6-fluoro-2-phenyl- structure
|
Common Name | 4H-1-Benzopyran-4-one,6-fluoro-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1218-82-2 | Molecular Weight | 240.22900 | |
| Density | 1.309g/cm3 | Boiling Point | 375.8ºC at 760mmHg | |
| Molecular Formula | C15H9FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.9ºC | |
| Name | 6-fluoro-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 375.8ºC at 760mmHg |
| Molecular Formula | C15H9FO2 |
| Molecular Weight | 240.22900 |
| Flash Point | 174.9ºC |
| Exact Mass | 240.05900 |
| PSA | 30.21000 |
| LogP | 3.59910 |
| Vapour Pressure | 7.56E-06mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | OUYOSBQKQPUNJK-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2ccc(F)cc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-Fluoroflavanone |
| 6-fluoro-2-phenyl-4H-1-benzopyran-4-one |
| 6-fluoro-2-phenyl-chromen-4-one |
| 6-fluoro-2-phenyl-4h-chromen-4-one |
| 6-Fluoroflavone |