Gly-Phe-Arg structure
|
Common Name | Gly-Phe-Arg | ||
|---|---|---|---|---|
| CAS Number | 121822-47-7 | Molecular Weight | 378.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Gly-Phe-ArgGly-Phe-Arg is a superpotent synthetic tripeptide mimics of the mud-crab pumping pheromone. |
| Name | Gly-Phe-Arg |
|---|
| Description | Gly-Phe-Arg is a superpotent synthetic tripeptide mimics of the mud-crab pumping pheromone. |
|---|---|
| Related Catalog | |
| In Vivo | Gly-Phe-Arg produces not only a statistically significant increase in the relative number of pumping mud crabs but also a substantial increase in the pumping rate ratio[1]. |
| References |
| Molecular Formula | C17H26N6O4 |
|---|---|
| Molecular Weight | 378.43 |
| InChIKey | FXLVSYVJDPCIHH-UHFFFAOYSA-N |
| SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| Storage condition | 2-8℃ |