Gly-Phe-Phe-OH structure
|
Common Name | Gly-Phe-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 13116-21-7 | Molecular Weight | 369.41400 | |
| Density | 1.261g/cm3 | Boiling Point | 721.4ºC at 760mmHg | |
| Molecular Formula | C20H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 390.1ºC | |
| Name | h-gly-phe-phe-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 721.4ºC at 760mmHg |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.41400 |
| Flash Point | 390.1ºC |
| Exact Mass | 369.16900 |
| PSA | 121.52000 |
| LogP | 1.96680 |
| Vapour Pressure | 7.69E-22mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | FEUPVVCGQLNXNP-IRXDYDNUSA-N |
| SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~%
Gly-Phe-Phe-OH CAS#:13116-21-7 |
| Literature: Journal of the American Chemical Society, , vol. 130, # 7 p. 2202 - 2212 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| GLYCYL-L-PHENYLALANYL-L-PHENYLALANINE |
| gly-phe-phe |
| Gly-Phe-Phe-OH |
| Gly-L-Phe-L-Phe-OH |