2-[(3μ,5μ-Difluorophenoxy)methyl]phenylboronic acid structure
|
Common Name | 2-[(3μ,5μ-Difluorophenoxy)methyl]phenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 1218790-92-1 | Molecular Weight | 264.03200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BF2O3 | Melting Point | 168-175 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [2-[(3,5-difluorophenoxy)methyl]phenyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 168-175 °C |
|---|---|
| Molecular Formula | C13H11BF2O3 |
| Molecular Weight | 264.03200 |
| Exact Mass | 264.07700 |
| PSA | 49.69000 |
| LogP | 1.22360 |
| InChIKey | HHJHWQLXFNFSHA-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccccc1COc1cc(F)cc(F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (2-((3,5-Difluorophenoxy)methyl)phenyl)boronic acid |
| 2-[(3 inverted exclamation marka,5 inverted exclamation marka-Difluorophenoxy)methyl]phenylboronic acid |