Dichloro[tris(2-methoxyphenyl)]-λ5-bismuthane structure
|
Common Name | Dichloro[tris(2-methoxyphenyl)]-λ5-bismuthane | ||
|---|---|---|---|---|
| CAS Number | 121899-81-8 | Molecular Weight | 601.276 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21BiCl2O3 | Melting Point | 183 °C(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dichlorotris(2-methoxyphenyl)bismuth |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 183 °C(dec.) |
|---|---|
| Molecular Formula | C21H21BiCl2O3 |
| Molecular Weight | 601.276 |
| Exact Mass | 600.067200 |
| PSA | 27.69000 |
| LogP | 5.86520 |
| InChIKey | VWHUHQRLABAFKC-UHFFFAOYSA-L |
| SMILES | COc1ccccc1[Bi](Cl)(Cl)(c1ccccc1OC)c1ccccc1OC |
|
~22%
Dichloro[tris(2... CAS#:121899-81-8 |
| Literature: Suzuki, Hitomi; Ikegami, Tohru; Azuma, Nagao Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 11 p. 1609 - 1616 |
|
~%
Dichloro[tris(2... CAS#:121899-81-8 |
| Literature: Journal of the Chemical Society - Perkin Transactions 1, , # 11 p. 1609 - 1616 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Tris(2-Methoxyphenyl)bisMuth Dichloride |
| Dichloro[tris(2-methoxyphenyl)]-λ-bismuthane |
| dichloro-tris(2-methoxyphenyl)bismuth |
| Bismuth, dichlorotris(2-methoxyphenyl)- |
| MFCD04038429 |