3-[tert-butyl(dimethyl)silyl]oxyaniline structure
|
Common Name | 3-[tert-butyl(dimethyl)silyl]oxyaniline | ||
|---|---|---|---|---|
| CAS Number | 121942-75-4 | Molecular Weight | 223.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[tert-butyl(dimethyl)silyl]oxyaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H21NOSi |
|---|---|
| Molecular Weight | 223.38700 |
| Exact Mass | 223.13900 |
| PSA | 35.25000 |
| LogP | 4.23400 |
| InChIKey | XBZVPWIDTDAKDL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(N)c1 |
|
~99%
3-[tert-butyl(d... CAS#:121942-75-4 |
| Literature: Petronijevic, Filip R.; Wipf, Peter Journal of the American Chemical Society, 2011 , vol. 133, # 20 p. 7704 - 7707 |
| 3-((tert-butyldimethylsilyl)oxy)aniline |
| 3-amino-O-(tert-butyldimethylsilyl)phenol |
| 3-(tert-butyl-dimethyl-silanyloxy)-phenylamine |
| 3-(tert-butyldimethylsilyloxy)benzenamine |
| Benzenamine,3-[[(1,1-dimethylethyl)dimethylsilyl]oxy] |