Nisoldipine-d4 structure
|
Common Name | Nisoldipine-d4 | ||
|---|---|---|---|---|
| CAS Number | 1219795-47-7 | Molecular Weight | 392.43900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20D4N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nisoldipine-d4Nisoldipine-d4 (BAY-k 5552-d4) is the deuterium labeled Nisoldipine. Nisoldipine(BAY-k 5552) is a calcium channel blocker belonging to the dihydropyridines class, specific for L-type Cav1.2 with IC50 of 10 nM[1][2]. |
| Name | Nisoldipine-d4 |
|---|
| Description | Nisoldipine-d4 (BAY-k 5552-d4) is the deuterium labeled Nisoldipine. Nisoldipine(BAY-k 5552) is a calcium channel blocker belonging to the dihydropyridines class, specific for L-type Cav1.2 with IC50 of 10 nM[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C20H20D4N2O6 |
|---|---|
| Molecular Weight | 392.43900 |
| Exact Mass | 392.18900 |
| PSA | 110.45000 |
| LogP | 4.05380 |
| InChIKey | VKQFCGNPDRICFG-YKVCKAMESA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC(C)C)C1c1ccccc1[N+](=O)[O-] |