3'-Nitroacetanilide structure
|
Common Name | 3'-Nitroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 122-28-1 | Molecular Weight | 180.16100 | |
| Density | 1.34g/cm3 | Boiling Point | 379ºC at 760mmHg | |
| Molecular Formula | C8H8N2O3 | Melting Point | 154-158 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 183ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3'-Nitroacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 379ºC at 760mmHg |
| Melting Point | 154-158 °C(lit.) |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16100 |
| Flash Point | 183ºC |
| Exact Mass | 180.05300 |
| PSA | 74.92000 |
| LogP | 2.14940 |
| Vapour Pressure | 6.04E-06mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | KFTYNYHJHKCRKU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
The absorption and first-pass metabolism of [14C]-1,3-dinitrobenzene in the isolated vascularly perfused rat small intestine.
Biopharm. Drug Dispos. 17(8) , 675-98, (1996) We tested the hypothesis that the small intestine is capable of the first-pass, reductive metabolism of xenobiotics. A simplified version of the isolated vascularly perfused rat small intestine was de... |
| 3′-Nitroacetanilide |
| N-(3-Nitrophenyl)acetamide |
| EINECS 204-532-6 |
| MFCD00017015 |