Mesulfamide structure
|
Common Name | Mesulfamide | ||
|---|---|---|---|---|
| CAS Number | 122-89-4 | Molecular Weight | 266.29500 | |
| Density | 1.702g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H10N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-sulfamoylanilino)methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.702g/cm3 |
|---|---|
| Molecular Formula | C7H10N2O5S2 |
| Molecular Weight | 266.29500 |
| Exact Mass | 266.00300 |
| PSA | 143.32000 |
| LogP | 2.52610 |
| Index of Refraction | 1.661 |
| InChIKey | AXUWLXLMZKNGIO-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(NCS(=O)(=O)O)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
Mesulfamide CAS#:122-89-4 |
| Literature: Hoffmann-La Roche Patent: US2339787 , 1936 ; Full Text Show Details Hoffmann-La Roche Patent: US2339788 , 1936 ; |
|
~%
Mesulfamide CAS#:122-89-4 |
| Literature: Rubzow Zhurnal Obshchei Khimii, 1940 , vol. 10, p. 831,840 Chem. Zentralbl., 1940 , vol. 111, # II p. 3475 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: ULK1_INH_LUMI_1536_1X%INH PRUN
|
| Mesulfamide |
| p-Sulfinamoylanilinmethansulfonsaeure |
| Mesulfamido |
| UNII-Y19VNL22L0 |
| (4-sulfamoyl-anilino)-methanesulfonic acid |
| Mesulfamide [INN] |
| Mesulfamidum |
| (4-Sulfamoylanilino)methansulfonsaeure |