ethyl 7-(3-fluorophenyl)-7-oxoheptanoate structure
|
Common Name | ethyl 7-(3-fluorophenyl)-7-oxoheptanoate | ||
|---|---|---|---|---|
| CAS Number | 122115-57-5 | Molecular Weight | 266.30800 | |
| Density | 1.09g/cm3 | Boiling Point | 359.6ºC at 760 mmHg | |
| Molecular Formula | C15H19FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.5ºC | |
| Name | ethyl 7-(3-fluorophenyl)-7-oxoheptanoate |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 359.6ºC at 760 mmHg |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.30800 |
| Flash Point | 165.5ºC |
| Exact Mass | 266.13200 |
| PSA | 43.37000 |
| LogP | 3.52200 |
| Vapour Pressure | 2.35E-05mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | SDFVHHUVZLHMDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCC(=O)c1cccc(F)c1 |
| HS Code | 2918300090 |
|---|
|
~86%
ethyl 7-(3-fluo... CAS#:122115-57-5 |
| Literature: Shiraishi; Kato; Terao; Ashida; Terashita; Kito Journal of Medicinal Chemistry, 1989 , vol. 32, # 9 p. 2214 - 2221 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |