2-Acetyloxy-1-(2,4-difluorophenyl)ethanone structure
|
Common Name | 2-Acetyloxy-1-(2,4-difluorophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 122263-03-0 | Molecular Weight | 214.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(2,4-difluorophenyl)-2-oxoethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8F2O3 |
|---|---|
| Molecular Weight | 214.16600 |
| Exact Mass | 214.04400 |
| PSA | 43.37000 |
| LogP | 1.71060 |
| InChIKey | OOCYQJABZIZEAJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)c1ccc(F)cc1F |
| Hazard Codes | Xi |
|---|
|
~%
2-Acetyloxy-1-(... CAS#:122263-03-0 |
| Literature: US5661151 A1, ; |
|
~94%
2-Acetyloxy-1-(... CAS#:122263-03-0 |
| Literature: Miyauchi, Hiroshi; Nakamura, Toshio; Ohashi, Naohito Bulletin of the Chemical Society of Japan, 1996 , vol. 69, # 9 p. 2625 - 2632 |
|
~%
2-Acetyloxy-1-(... CAS#:122263-03-0 |
| Literature: Acetti, Daniela; Brenna, Elisabetta; Fuganti, Claudio; Gatti, Francesco G.; Serra, Stefano Tetrahedron Asymmetry, 2009 , vol. 20, # 20 p. 2413 - 2420 |
| 2-(2,4-difluorophenyl)-2-oxoethyl acetate |
| 2-(2,4-Difluorophenyl)-2-oxoethyl acetate |
| 2-acetoxy-1-(2,4-difluorophenyl)ethanone |
| Ethanone,2-(acetyloxy)-1-(2,4-difluorophenyl) |
| 2-ACETOXY-2,4-DIFLUOROACETOPHENONE |
| 2-ACETYLOXY-1-(2,4-DIFLUOROPHENYL)ETHANONE |