2-T-butyl-4-(1,1-dimethylpropyl)-phenol structure
|
Common Name | 2-T-butyl-4-(1,1-dimethylpropyl)-phenol | ||
|---|---|---|---|---|
| CAS Number | 122269-03-8 | Molecular Weight | 220.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-tert-butyl-4-(2-methylbutan-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O |
|---|---|
| Molecular Weight | 220.35000 |
| Exact Mass | 220.18300 |
| PSA | 20.23000 |
| LogP | 4.37730 |
| InChIKey | NZRSIUKTGLRKIQ-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(O)c(C(C)(C)C)c1 |
|
~91%
2-T-butyl-4-(1,... CAS#:122269-03-8 |
| Literature: Esguerra, Kenneth Virgel N.; Fall, Yacoub; Petitjean, Laurene; Lumb, Jean-Philip Journal of the American Chemical Society, 2014 , vol. 136, # 21 p. 7662 - 7668 |
|
~11%
Detail
|
| Literature: CHEMTURA CORPORATION; GELBIN, Michael, E.; POWER, Maurice; HILL, Jonathan Patent: WO2011/14405 A1, 2011 ; Location in patent: Page/Page column 42 ; |
| 2-t-butyl-4-(1,1-dimethylpropyl)-phenol |
| 2-t-butyl-4-tert-pentylphenol |
| Phenol,2-(1,1-dimethylethyl)-4-(1,1-dimethylpropyl) |
| 4-t-amyl-2-t-butylphenol |
| 2-tert-butyl-4-(1,1-dimethyl-propyl)-phenol |
| 2-t-butyl-4-t-amyl-phenol |
| 2-tert.Butyl-4-tert.pentyl-phenol |