3-amino-5-phenylthiophene-2-carboxamide structure
|
Common Name | 3-amino-5-phenylthiophene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 122375-70-6 | Molecular Weight | 218.27500 | |
| Density | 1.321g/cm3 | Boiling Point | 426.4ºC at 760mmHg | |
| Molecular Formula | C11H10N2OS | Melting Point | N/A | |
| MSDS | USA | Flash Point | 211.7ºC | |
| Name | 3-amino-5-phenylthiophene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 426.4ºC at 760mmHg |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.27500 |
| Flash Point | 211.7ºC |
| Exact Mass | 218.05100 |
| PSA | 97.35000 |
| LogP | 3.37770 |
| Vapour Pressure | 1.77E-07mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | DYRYDYQWWQHRQE-UHFFFAOYSA-N |
| SMILES | NC(=O)c1sc(-c2ccccc2)cc1N |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~43%
3-amino-5-pheny... CAS#:122375-70-6 |
| Literature: LAILA NUTRACEUTICALS Patent: US2010/68178 A1, 2010 ; Location in patent: Page/Page column 19 ; |
|
~%
3-amino-5-pheny... CAS#:122375-70-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 11 p. 2817 - 2822 |
|
~%
3-amino-5-pheny... CAS#:122375-70-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 11 p. 2817 - 2822 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Thiophenecarboxamide,3-amino-5-phenyl |
| 3-Amino-5-phenyl-2-thiophenecarboxamide |