1 3-BIS[BIS(2-PYRIDYLMETHYL)AMINO]-2-PRO structure
|
Common Name | 1 3-BIS[BIS(2-PYRIDYLMETHYL)AMINO]-2-PRO | ||
|---|---|---|---|---|
| CAS Number | 122413-32-5 | Molecular Weight | 454.56700 | |
| Density | 0.817 g/mL at 20ºC(lit.) | Boiling Point | 643.235ºC at 760 mmHg | |
| Molecular Formula | C27H30N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 12ºC | |
| Name | 1,3-bis[bis(pyridin-2-ylmethyl)amino]propan-2-ol |
|---|
| Density | 0.817 g/mL at 20ºC(lit.) |
|---|---|
| Boiling Point | 643.235ºC at 760 mmHg |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.56700 |
| Flash Point | 12ºC |
| Exact Mass | 454.24800 |
| PSA | 78.27000 |
| LogP | 3.33210 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | XLUMWNJFCFABKI-UHFFFAOYSA-N |
| SMILES | OC(CN(Cc1ccccn1)Cc1ccccn1)CN(Cc1ccccn1)Cc1ccccn1 |
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | S16 |
| RIDADR | UN 1219 3/PG 2 |
|
~%
1 3-BIS[BIS(2-P... CAS#:122413-32-5 |
| Literature: Journal of the American Chemical Society, , vol. 115, # 5 p. 1851 - 1859 |
|
~73%
1 3-BIS[BIS(2-P... CAS#:122413-32-5 |
| Literature: Sato; Mori; Iida Synthesis, 1992 , # 6 p. 539 - 540 |
|
~%
1 3-BIS[BIS(2-P... CAS#:122413-32-5 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 63, # 4 p. 1115 - 1120 |