(2-morpholin-4-yl-6-nitro-2H-chromen-3-yl)-phenylmethanone structure
|
Common Name | (2-morpholin-4-yl-6-nitro-2H-chromen-3-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 122438-06-6 | Molecular Weight | 366.36700 | |
| Density | 1.358g/cm3 | Boiling Point | 558ºC at 760 mmHg | |
| Molecular Formula | C20H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.3ºC | |
| Name | (2-morpholin-4-yl-6-nitro-2H-chromen-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 558ºC at 760 mmHg |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.36700 |
| Flash Point | 291.3ºC |
| Exact Mass | 366.12200 |
| PSA | 84.59000 |
| LogP | 3.37290 |
| Vapour Pressure | 1.74E-12mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | QSXUIEUSTUHSFC-UHFFFAOYSA-N |
| SMILES | O=C(C1=Cc2cc([N+](=O)[O-])ccc2OC1N1CCOCC1)c1ccccc1 |
|
~48%
(2-morpholin-4-... CAS#:122438-06-6 |
| Literature: Rene; El Cherif; Boschi; Reny-Palasse; Rips European Journal of Medicinal Chemistry, 1988 , vol. 23, # 6 p. 592 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanone,(2-(4-morpholinyl)-6-nitro-2H-1-benzopyran-3-yl)phenyl |
| (2-(4-Morpholinyl)-6-nitro-2H-1-benzopyran-3-yl)phenylmethanone |