GBLD345 structure
|
Common Name | GBLD345 | ||
|---|---|---|---|---|
| CAS Number | 122479-08-7 | Molecular Weight | 375.424 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GBLD345GBLD345, a nonbenzodiazepine anxiolytic agent, is a non- selective, potent GABAA receptor positive allosteric modulator (PAM)[1]. |
| Name | GBLD-345 |
|---|---|
| Synonym | More Synonyms |
| Description | GBLD345, a nonbenzodiazepine anxiolytic agent, is a non- selective, potent GABAA receptor positive allosteric modulator (PAM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.424 |
| Exact Mass | 375.169525 |
| LogP | 2.33 |
| Index of Refraction | 1.658 |
| InChIKey | HQRHGSRWOHGIRI-UHFFFAOYSA-N |
| SMILES | COc1cccc(CNc2ccc3nc(-c4ccc(N)cc4)c(OC)n3n2)c1 |
| 2-(4-Aminophenyl)-3-methoxy-N-(3-methoxybenzyl)imidazo[1,2-b]pyridazin-6-amine |
| Imidazo[1,2-b]pyridazin-6-amine, 2-(4-aminophenyl)-3-methoxy-N-[(3-methoxyphenyl)methyl]- |
| GBLD-345 |