Butanedioic acid,2,3-diphenyl-, (2R,3S)-rel- structure
|
Common Name | Butanedioic acid,2,3-diphenyl-, (2R,3S)-rel- | ||
|---|---|---|---|---|
| CAS Number | 1225-13-4 | Molecular Weight | 270.28000 | |
| Density | 1.307g/cm3 | Boiling Point | 360.2ºC at 760mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8ºC | |
| Name | meso-2,3-Diphenylsuccinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307g/cm3 |
|---|---|
| Boiling Point | 360.2ºC at 760mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 185.8ºC |
| Exact Mass | 270.08900 |
| PSA | 74.60000 |
| LogP | 2.72320 |
| Vapour Pressure | 8.13E-06mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | PVXCQHHWNDJIJP-OKILXGFUSA-N |
| SMILES | O=C(O)C(c1ccccc1)C(C(=O)O)c1ccccc1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Succinic acid,2,3-diphenyl-,meso |
| Meso-2,3-Diphenylsuccinic Acid |
| MESO-2,3-DIPHENYLBUTANEDIOIC ACID |
| meso-2,3-diphenyl-succinic acid |
| EINECS 214-953-7 |