11-Hydroxyhumantenine structure
|
Common Name | 11-Hydroxyhumantenine | ||
|---|---|---|---|---|
| CAS Number | 122590-04-9 | Molecular Weight | 370.44 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 536.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.4±32.9 °C | |
Use of 11-Hydroxyhumantenine11-Hydroxyhumantenine is an alkaloid compound isolated from the EtOH extract of the stems of Gelsemium elegans[1]. |
| Name | 11-Hydroxyhumantenine |
|---|---|
| Synonym | More Synonyms |
| Description | 11-Hydroxyhumantenine is an alkaloid compound isolated from the EtOH extract of the stems of Gelsemium elegans[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.6±60.0 °C at 760 mmHg |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.44 |
| Flash Point | 278.4±32.9 °C |
| Exact Mass | 370.189270 |
| PSA | 62.24000 |
| LogP | 2.69 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | VYZFRSLZSBLYIC-CFRXDJQUSA-N |
| SMILES | CC=C1CN(C)C2CC3(C(=O)N(OC)c4cc(O)ccc43)C3CC1C2CO3 |
| Hazard Codes | Xi |
|---|
| Humantenine,11-hydroxy |
| (7'Z)-7'-Ethylidene-6-hydroxy-1-methoxy-5'-methylspiro[indole-3,2'-[11]oxa[5]azatricyclo[6.3.1.0]dodecan]-2(1H)-one |
| N-Methyl-11-hydroxyrankinidine |