Urea,N,N'-bis(2-methoxyphenyl)- structure
|
Common Name | Urea,N,N'-bis(2-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1226-63-7 | Molecular Weight | 272.29900 | |
| Density | 1.249g/cm3 | Boiling Point | 337.6ºC at 760mmHg | |
| Molecular Formula | C15H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | 1,3-bis(2-methoxyphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 337.6ºC at 760mmHg |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.29900 |
| Flash Point | 158ºC |
| Exact Mass | 272.11600 |
| PSA | 59.59000 |
| LogP | 3.49380 |
| Vapour Pressure | 0.000104mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | AXLDWMVASPWDQF-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)Nc1ccccc1OC |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-di(2-methoxyphenyl)urea |
| Di-o-anisylharnstoff |
| N,N'-bis-(2-methoxy-phenyl)-urea |
| N,N'-Bis-(2-methoxy-phenyl)-harnstoff |
| 2,2'-DIMETHOXYCARBANILIDE |
| 1,3-bis(o-anisoyl)urea |