4-Nitro-o-anisidine structure
|
Common Name | 4-Nitro-o-anisidine | ||
|---|---|---|---|---|
| CAS Number | 97-52-9 | Molecular Weight | 168.150 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 364.2±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | 140-142 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 174.0±22.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Methoxy-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.2±22.0 °C at 760 mmHg |
| Melting Point | 140-142 °C(lit.) |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 174.0±22.3 °C |
| Exact Mass | 168.053497 |
| PSA | 81.07000 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | GVBHRNIWBGTNQA-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1N |
| Water Solubility | slightly soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S37/39-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | BZ7170000 |
| Hazard Class | 6.1 |
| HS Code | 29222900 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
2-Methoxy-4-nitroaniline is a selective inducer of cytochrome P450IA2 (CYP1A2) in rat liver.
Cancer Lett. 96(1) , 95-8, (1995) Male F344 rats were treated with a chemical (aniline, nitrobenzene, 2-methoxy-p-phenylenediamine, 2-methoxy-4-nitroaniline or 2-methoxy-4-nitroazobenzene) produced by the azo-reduction and/or N-oxidat... |
|
|
Metabolism and disposition of 2-methoxy-4-nitroaniline in male and female Harlan Sprague Dawley rats and B6C3F1/N mice.
Xenobiotica 42(12) , 1213-24, (2012) The disposition of 2-Methoxy-4-nitroaniline (MNA) was investigated in male and female Harlan Sprague Dawley rats and B6C3F(1)/N mice following oral, intravenous, and dermal exposure to [(14)C]MNA at 2... |
|
|
Use of nitroanilines for spectrophotometric determination of ethinylestradiol in pharmaceutical formulations. Leonardo SG, et al.
Anal. Methods 3(5) , 1198-1201, (2011)
|
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Primary Screen Inhibitors of CD40 Signaling in BL2 Cells Measured in Cell-Based Syste...
Source: Broad Institute
Target: N/A
External Id: 7124-01_Inhibitor_SinglePoint_HTS_Activity
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
| 2-METHOXY-4-NITROANILINE/4-NITRO-O-ANISIDINE |
| EINECS 202-588-6 |
| 2-Amino-5-nitroanisole |
| 2-amino-5-nitroanisol |
| 2-methoxy-4nitro-aniline |
| 4-Nitro-o-anisidine |
| KERNECHTROT SALT B |
| 2-Methoxy-4-nitrobenzenamine |
| 2-METHOXY-4-NITRO-ANILINE 97-52-9 |
| 2-Methoxy-4-nitroaniline |
| 2-METHOXY-4-NITROANILINE FOR SYNTHESIS |
| Red B Base |
| 2-methoxy-4-nitrophenylamine |
| 1-amino-2-methoxy-4-nitrobenzene |
| Fast Red B |
| 2-Amino-1-methoxy-5-nitrobenzene |
| 2-METHOXY-4-NITROANILIN |
| 4-Nitro-6-methoxyaniline |
| 5-nitro-2-amino-1-methoxy-benzene |
| Fast Red Base B |
| Benzenamine,2-methoxy-4-nitro |
| o-Anisidine,4-nitro |
| 2-METHOXY-4-NITRO ANILINE |
| 5-Nitro-2-anisidine |
| 5-nitro-2-amino-anisole |
| MFCD00007363 |
| 4-Amino-3-methoxynitrobenzene |
| 4-NITRO-O-ANISIDINE (NH2=1) |
| Fast Red B Base |
| FASTREDBBASE |