5(4H)-Oxazolone,4-[(4-hydroxyphenyl)methylene]-2-phenyl- structure
|
Common Name | 5(4H)-Oxazolone,4-[(4-hydroxyphenyl)methylene]-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1226-71-7 | Molecular Weight | 265.26300 | |
| Density | 1.26g/cm3 | Boiling Point | 433.5ºC at 760mmHg | |
| Molecular Formula | C16H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | (4Z)-4-[(4-hydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760mmHg |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.26300 |
| Flash Point | 215.9ºC |
| Exact Mass | 265.07400 |
| PSA | 58.89000 |
| LogP | 2.17230 |
| Vapour Pressure | 4.04E-08mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | GOSVXNVSKHMEIP-GXDHUFHOSA-N |
| SMILES | O=C1OC(c2ccccc2)=NC1=Cc1ccc(O)cc1 |
|
~90%
5(4H)-Oxazolone... CAS#:1226-71-7 |
| Literature: Synthetic Communications, , vol. 30, # 4 p. 707 - 712 |
|
~72%
5(4H)-Oxazolone... CAS#:1226-71-7 |
| Literature: Journal of the Indian Chemical Society, , vol. 59, # 7 p. 867 - 868 |
|
~%
5(4H)-Oxazolone... CAS#:1226-71-7 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 53, # 9 p. 1067 - 1072 |
|
~%
5(4H)-Oxazolone... CAS#:1226-71-7 |
| Literature: Medicinal Chemistry Research, , vol. 21, # 4 p. 459 - 467 |
|
~%
5(4H)-Oxazolone... CAS#:1226-71-7 |
| Literature: Journal of the Indian Chemical Society, , vol. 63, p. 757 - 758 |
| ethyl 4-[(1E)-2-(4-hydroxyphenyl)-1-azavinyl]benzoate |
| 4-(4-hydroxy-benzylidene)-2-phenyl-4H-oxazol-5-one |
| 4-(4-hydroxy-benzylidenamino)-benzoic acid ethyl ester |
| Ethyl 4-(p-hydroxybenzylidene)aminobenzoate |
| 4-(4'-hydroxybenzylidene)-2-phenyl-4-oxazolone |
| 4-(4-Hy<droxy-benzyliden)-2-phenyl-oxazol-5-on |
| 4-(4-Hydroxy-benzylidenamino)-benzoesaeure-aethylester |
| BENZOIC ACID,p-((p-HYDROXYBENZYLIDENE)AMINO)-,ETHYL ESTER |
| 4-(4-Oxy-benzalamino)-benzoesaeure-aethylester |
| 2-phenyl-4-[[4-hydroxyphenyl]methylene]-5(4H)-oxazolone |
| 4-(p-hydroxybenzylidene)-2-phenyl-5-oxazolone |