N-hexyl-N-(2-nitrothiophen-3-yl)acetamide structure
|
Common Name | N-hexyl-N-(2-nitrothiophen-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 122777-71-3 | Molecular Weight | 270.34800 | |
| Density | 1.202g/cm3 | Boiling Point | 412.4ºC at 760mmHg | |
| Molecular Formula | C12H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.2ºC | |
| Name | N-hexyl-N-(2-nitrothiophen-3-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 412.4ºC at 760mmHg |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.34800 |
| Flash Point | 203.2ºC |
| Exact Mass | 270.10400 |
| PSA | 94.37000 |
| LogP | 4.11270 |
| Vapour Pressure | 5.2E-07mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | LJKMIELWDIVIFR-UHFFFAOYSA-N |
| SMILES | CCCCCCN(C(C)=O)c1ccsc1[N+](=O)[O-] |
|
~%
N-hexyl-N-(2-ni... CAS#:122777-71-3 |
| Literature: Ronsisvalle, Giuseppe; Pappalardo, Maria S.; Vittorio, Franco; Pasquinucci, Lorella; Caruso, Antonina; et al. European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 553 - 560 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Acetamide,N-hexyl-N-(2-nitro-3-thienyl) |
| N-Hexyl-N-(2-nitro-3-thienyl)acetamide |