N-butyl-N-(2-nitrothiophen-3-yl)acetamide structure
|
Common Name | N-butyl-N-(2-nitrothiophen-3-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 122777-70-2 | Molecular Weight | 242.29500 | |
| Density | 1.262g/cm3 | Boiling Point | 389.2ºC at 760mmHg | |
| Molecular Formula | C10H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | N-butyl-N-(2-nitrothiophen-3-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 389.2ºC at 760mmHg |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.29500 |
| Flash Point | 189.2ºC |
| Exact Mass | 242.07300 |
| PSA | 94.37000 |
| LogP | 3.33250 |
| Vapour Pressure | 2.91E-06mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | WRLIXCPYCQJUQP-UHFFFAOYSA-N |
| SMILES | CCCCN(C(C)=O)c1ccsc1[N+](=O)[O-] |
|
~92%
N-butyl-N-(2-ni... CAS#:122777-70-2 |
| Literature: Ronsisvalle, Giuseppe; Pappalardo, Maria S.; Vittorio, Franco; Pasquinucci, Lorella; Caruso, Antonina; et al. European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 553 - 560 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| LS-8420 |
| N-Butyl-N-(2-nitro-3-thienyl)acetamide |
| Acetamide,N-butyl-N-(2-nitro-3-thienyl) |