N-[3-[acetyl(butyl)amino]thiophen-2-yl]acetamide structure
|
Common Name | N-[3-[acetyl(butyl)amino]thiophen-2-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 122777-76-8 | Molecular Weight | 254.34900 | |
| Density | 1.193g/cm3 | Boiling Point | 455.8ºC at 760 mmHg | |
| Molecular Formula | C12H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
| Name | N-[3-[acetyl(butyl)amino]thiophen-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 455.8ºC at 760 mmHg |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.34900 |
| Flash Point | 229.5ºC |
| Exact Mass | 254.10900 |
| PSA | 81.14000 |
| LogP | 3.50900 |
| Vapour Pressure | 1.7E-08mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | MEYIDFHICPQESD-UHFFFAOYSA-N |
| SMILES | CCCCN(C(C)=O)c1ccsc1NC(C)=O |
|
~81%
N-[3-[acetyl(bu... CAS#:122777-76-8 |
| Literature: Ronsisvalle, Giuseppe; Pappalardo, Maria S.; Vittorio, Franco; Pasquinucci, Lorella; Caruso, Antonina; et al. European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 553 - 560 |
|
~%
N-[3-[acetyl(bu... CAS#:122777-76-8 |
| Literature: Ronsisvalle, Giuseppe; Pappalardo, Maria S.; Vittorio, Franco; Pasquinucci, Lorella; Caruso, Antonina; et al. European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 553 - 560 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(2-(Acetylamino)-3-thienyl)-N-butylacetamide |
| N-(2-ACETAMIDOTHIOPHEN-3-YL)-N-BUTYL-ACETAMIDE |
| Acetamide,N-(2-(acetylamino)-3-thienyl)-N-butyl |
| LS-7953 |