(1r)-trans-n n'-1 2-cyclohexanediylbis-& structure
|
Common Name | (1r)-trans-n n'-1 2-cyclohexanediylbis-& | ||
|---|---|---|---|---|
| CAS Number | 122833-60-7 | Molecular Weight | 378.312 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 345.8±52.0 °C at 760 mmHg | |
| Molecular Formula | C8H12F6N2O4S2 | Melting Point | 185-187ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 163.0±30.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,1,1-trifluoro-N-[(1R,2R)-2-(trifluoromethylsulfonylamino)cyclohexyl]methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.8±52.0 °C at 760 mmHg |
| Melting Point | 185-187ºC(lit.) |
| Molecular Formula | C8H12F6N2O4S2 |
| Molecular Weight | 378.312 |
| Flash Point | 163.0±30.7 °C |
| Exact Mass | 378.014252 |
| PSA | 109.10000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | GKSGSDYYIYURPD-PHDIDXHHSA-N |
| SMILES | O=S(=O)(NC1CCCCC1NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~59%
(1r)-trans-n n'... CAS#:122833-60-7 |
| Literature: Ostwald, Roswitha; Chavant, Pierre-Yves; Stadtmueller, Heinz; Knochel, Paul Journal of Organic Chemistry, 1994 , vol. 59, # 15 p. 4143 - 4153 |
|
~%
(1r)-trans-n n'... CAS#:122833-60-7 |
| Literature: Denmark, Scott E.; Christenson, Beritte L.; O'Connor, Stephen P. Tetrahedron Letters, 1995 , vol. 36, # 13 p. 2219 - 2222 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Methanesulfonamide, N,N'-(1R,2R)-1,2-cyclohexanediylbis[1,1,1-trifluoro- |
| N,N'-((1R,2R)-cyclohexane-1,2-diyl)bis(1,1,1-trifluoromethanesulfonamide) |
| FORMAMIDINE,N,N''-THIOBIS(N-METHYL-N'-(2,4-XYLYL) |
| 2R-cyclohexane-1,2-diyl)bis(trifluoromethanesulfonamide)) |
| (1R,2R)-N,N'-bis(trifluoromethylsulfonyl)-1,2-cyclohexanediamine |
| N,N''-Thiobis(N-methyl-N'-2,4-xylylformamidine) |
| N,N'-(1R,2R)-1,2-Cyclohexanediylbis(1,1,1-trifluoromethanesulfonamide) |
| trans-(R,R)-N,N'-Bis(trifluormethylsulfonyl)-1,2-cyclohexandiamin |
| MFCD01863491 |
| N,N'-((1R,2R)-cyclohexane-1,2-diyl)bis(1,1,1-trifluoromethansulfonamide) |
| (1R,2R)-N,N'-bis(trifluoromethanesulfonyl)-1,2-cyclohexanediamine |
| (1R,2R)-1,2-Bis<(trifluoromethyl)sulfonamido>cyclohexane |
| N,N"-thiobis[N'-(2,4-xylyl)-N-methylformamidine] |