2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one structure
|
Common Name | 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one | ||
|---|---|---|---|---|
| CAS Number | 122852-75-9 | Molecular Weight | 200.236 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 508.0±39.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.1±27.1 °C | |
| Name | 2,3,4,5-Tetrahydro-5-methyl-1H-pyrido[4,3-b]indol-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.0±39.0 °C at 760 mmHg |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.236 |
| Flash Point | 261.1±27.1 °C |
| Exact Mass | 200.094955 |
| PSA | 34.03000 |
| LogP | 1.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | GLHMAFAXJJECMG-UHFFFAOYSA-N |
| SMILES | Cn1c2c(c3ccccc31)C(=O)NCC2 |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
|
~73%
2,3,4,5-Tetrahy... CAS#:122852-75-9 |
| Literature: AUSPEX PHARMACEUTICALS, INC. Patent: US2010/113478 A1, 2010 ; Location in patent: Page/Page column 12 ; |
|
~%
2,3,4,5-Tetrahy... CAS#:122852-75-9 |
| Literature: US5196534 A1, ; US 5196534 A |
|
~%
2,3,4,5-Tetrahy... CAS#:122852-75-9 |
| Literature: US5196534 A1, ; US 5196534 A |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of Streptococcus pyogenes SrtA deltaN81 mutant expressed in Escherichia co...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4326773
|
| MFCD08458716 |
| 2,3,3',4,4',5-HEXACDE |
| 5-Methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-1-one |
| Alosetron InterMediates |