N-((4-(2-(Dimethylamino)ethoxy)phenyl)methyl)-3-nitrobenzamide structure
|
Common Name | N-((4-(2-(Dimethylamino)ethoxy)phenyl)methyl)-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 122892-80-2 | Molecular Weight | 343.37700 | |
| Density | 1.212g/cm3 | Boiling Point | 541.1ºC at 760mmHg | |
| Molecular Formula | C18H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281ºC | |
| Name | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760mmHg |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.37700 |
| Flash Point | 281ºC |
| Exact Mass | 343.15300 |
| PSA | 90.88000 |
| LogP | 3.56320 |
| Vapour Pressure | 9.01E-12mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | GNHJCPGGHGYXHT-UHFFFAOYSA-N |
| SMILES | CN(C)CCOc1ccc(CNC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
|
~%
N-((4-(2-(Dimet... CAS#:122892-80-2 |
| Literature: Sakaguchi; Nishino; Ogawa; Iwanaga; Yasuda; Kato; Ito Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 202 - 211 |
|
~%
N-((4-(2-(Dimet... CAS#:122892-80-2 |
| Literature: Sakaguchi; Nishino; Ogawa; Iwanaga; Yasuda; Kato; Ito Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 202 - 211 |
| Benzamide,N-((4-(2-(dimethylamino)ethoxy)phenyl)methyl)-3-nitro |
| N-((4-(2-(Dimethylamino)ethoxy)phenyl)methyl)-3-nitrobenzamide |
| N-[[4-(2-dimethylaminoethyloxy)phenyl]methyl]-3-nitrobenzamide |