Potassium (2-phenylacetyl)trifluoroborate structure
|
Common Name | Potassium (2-phenylacetyl)trifluoroborate | ||
|---|---|---|---|---|
| CAS Number | 1229039-50-2 | Molecular Weight | 226.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7BF3KO | Melting Point | 178-183°C (d) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Potassium (2-phenylacetyl)trifluoroborate |
|---|
| Melting Point | 178-183°C (d) |
|---|---|
| Molecular Formula | C8H7BF3KO |
| Molecular Weight | 226.05 |
| Appearance of Characters | powder |
| InChIKey | SEOSMCJOPUBHBF-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)[B-](F)(F)F.[K+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Amide-forming ligation of acyltrifluoroborates and hydroxylamines in water.
Angew. Chem. Int. Ed. Engl. 51(23) , 5683-6, (2012)
|
|
|
Organotrifluoroborates: Expanding Organoboron Chemistry Molander GA and Figueroa RF
Aldrichimica Acta 38(2) , 58, (2005)
|