3-tert-butyl-2-hydroxy-5-methoxybenzaldehyde structure
|
Common Name | 3-tert-butyl-2-hydroxy-5-methoxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 123013-13-8 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-2-hydroxy-5-methoxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 46.53000 |
| LogP | 2.51080 |
| InChIKey | BSOBIHUVDDETHG-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)c(O)c(C(C)(C)C)c1 |
|
~90%
3-tert-butyl-2-... CAS#:123013-13-8 |
| Literature: Menage, Stepane; Gellon, Gisele; Pierre, Jean-Louis; Zurita, Dacil; Saint-Aman, Eric Bulletin de la Societe Chimique de France, 1997 , vol. 134, # 8-9 p. 785 - 792 |
|
~%
3-tert-butyl-2-... CAS#:123013-13-8 |
| Literature: Kurahashi, Takuya; Fujii, Hiroshi Journal of the American Chemical Society, 2011 , vol. 133, # 21 p. 8307 - 8316 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 5-MeO-3-(t-Bu)-salicylaldehyde |
| 3-tert-butyl-2-hydroxy-5-methoxy-benzaldehyde |
| Benzaldehyde,3-(1,1-dimethylethyl)-2-hydroxy-5-methoxy |
| 2-hydroxy-3-tert-butyl-5-methoxy-benzaldehyde |
| 3-tert-butyl-4-methoxy-2-hydroxybenzaldehyde |
| 2-tert-butyl-6-formyl-4-methoxyphenol |