Benzoicacid, 3-(1,1-dimethylethyl)-2-hydroxy-5-methoxy structure
|
Common Name | Benzoicacid, 3-(1,1-dimethylethyl)-2-hydroxy-5-methoxy | ||
|---|---|---|---|---|
| CAS Number | 6291-15-2 | Molecular Weight | 224.25300 | |
| Density | 1.173g/cm3 | Boiling Point | 353.8ºC at 760mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.5ºC | |
| Name | 3-tert-butyl-2-hydroxy-5-methoxybenzoic acid |
|---|
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25300 |
| Flash Point | 132.5ºC |
| Exact Mass | 224.10500 |
| PSA | 66.76000 |
| LogP | 2.39650 |
| Index of Refraction | 1.541 |
| InChIKey | XDEGFEIFKRWJQI-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(O)c(C(C)(C)C)c1 |
| HS Code | 2918990090 |
|---|
|
~24%
Benzoicacid, 3-... CAS#:6291-15-2 |
| Literature: Yang, Jenny Y.; Nocera, Daniel G. Tetrahedron Letters, 2008 , vol. 49, # 32 p. 4796 - 4798 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|